C23H27N3O4S — CID 157201959
6-[5-[(1,1-dioxothiolan-3-yl)methyl]-1,3,4-oxadiazol-2-yl]-2,2,4,4-tetramethyl-3,9-dihydrocarbazol-1-one (PubChem CID 157201959) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 6-[5-[(1,1-dioxothiolan-3-yl)methyl]-1,3,4-oxadiazol-2-yl]-2,2,4,4-tetramethyl-3,9-dihydrocarbazol-1-one.
| Compound Name | 6-[5-[(1,1-dioxothiolan-3-yl)methyl]-1,3,4-oxadiazol-2-yl]-2,2,4,4-tetramethyl-3,9-dihydrocarbazol-1-one |
|---|---|
| PubChem CID | 157201959 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 6-[5-[(1,1-dioxothiolan-3-yl)methyl]-1,3,4-oxadiazol-2-yl]-2,2,4,4-tetramethyl-3,9-dihydrocarbazol-1-one |
| SMILES | CC1(C)CC(C)(C)c2c([nH]c3ccc(-c4nnc(CC5CCS(=O)(=O)C5)o4)cc23)C1=O |
| InChI | InChI=1S/C23H27N3O4S/c1-22(2)12-23(3,4)20(27)19-18(22)15-10-14(5-6-16(15)24-19)21-26-25-17(30-21)9-13-7-8-31(28,29)11-13/h5-6,10,13,24H,7-9,11-12H2,1-4H3 |
| InChIKey | JIVQFZOLTXDRHM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |