C28H39N3O7P2S4 — CID 157207650
2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane;tert-butyl 4-(acetamidocarbamoyl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 157207650) has the molecular formula C28H39N3O7P2S4 and a molecular weight of 719.85 g/mol. Its IUPAC name is 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane;tert-butyl 4-(acetamidocarbamoyl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane;tert-butyl 4-(acetamidocarbamoyl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 157207650 |
| Molecular Formula | C28H39N3O7P2S4 |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.11 |
| IUPAC Name | 2,4-bis(4-methoxyphenyl)-2,4-bis(sulfanylidene)-1,3,2λ5,4λ5-dithiadiphosphetane;tert-butyl 4-(acetamidocarbamoyl)-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)NNC(=O)C1(C)COC(C)(C)N1C(=O)OC(C)(C)C.COc1ccc(P2(=S)SP(=S)(c3ccc(OC)cc3)S2)cc1 |
| InChI | InChI=1S/C14H25N3O5.C14H14O2P2S4/c1-9(18)15-16-10(19)14(7)8-21-13(5,6)17(14)11(20)22-12(2,3)4;1-15-11-3-7-13(8-4-11)17(19)21-18(20,22-17)14-9-5-12(16-2)6-10-14/h8H2,1-7H3,(H,15,18)(H,16,19);3-10H,1-2H3 |
| InChIKey | ARNMBAXCXYVOJT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|