C23H30F3N3O6 — CID 59384294
tert-butyl (4R)-2,2,4-trimethyl-4-[[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 59384294) has the molecular formula C23H30F3N3O6 and a molecular weight of 501.50 g/mol. Its IUPAC name is tert-butyl (4R)-2,2,4-trimethyl-4-[[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2,4-trimethyl-4-[[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59384294 |
| Molecular Formula | C23H30F3N3O6 |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | tert-butyl (4R)-2,2,4-trimethyl-4-[[[4-prop-2-enoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCOc1ccc(C(=O)NNC(=O)[C@@]2(C)COC(C)(C)N2C(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C23H30F3N3O6/c1-8-11-33-16-10-9-14(12-15(16)23(24,25)26)17(30)27-28-18(31)22(7)13-34-21(5,6)29(22)19(32)35-20(2,3)4/h8-10,12H,1,11,13H2,2-7H3,(H,27,30)(H,28,31)/t22-/m1/s1 |
| InChIKey | SOSRZQFPPCTYML-JOCHJYFZSA-N |
| XLogP | 3.79 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|