C31H36F3N3O7 — CID 143621996
tert-butyl (4S)-4-ethynyl-2,2-dimethyl-4-[[[4-(3-phenylmethoxypropoxy)-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 143621996) has the molecular formula C31H36F3N3O7 and a molecular weight of 619.64 g/mol. Its IUPAC name is tert-butyl (4S)-4-ethynyl-2,2-dimethyl-4-[[[4-(3-phenylmethoxypropoxy)-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-ethynyl-2,2-dimethyl-4-[[[4-(3-phenylmethoxypropoxy)-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 143621996 |
| Molecular Formula | C31H36F3N3O7 |
| Molecular Weight | 619.64 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | tert-butyl (4S)-4-ethynyl-2,2-dimethyl-4-[[[4-(3-phenylmethoxypropoxy)-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C#C[C@@]1(C(=O)NNC(=O)c2ccc(OCCCOCc3ccccc3)c(C(F)(F)F)c2)COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H36F3N3O7/c1-7-30(20-43-29(5,6)37(30)27(40)44-28(2,3)4)26(39)36-35-25(38)22-14-15-24(23(18-22)31(32,33)34)42-17-11-16-41-19-21-12-9-8-10-13-21/h1,8-10,12-15,18H,11,16-17,19-20H2,2-6H3,(H,35,38)(H,36,39)/t30-/m0/s1 |
| InChIKey | DGDZYKYKYYZXCL-PMERELPUSA-N |
| XLogP | 4.83 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|