C28H40F3N3O4S — CID 59384428
tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 59384428) has the molecular formula C28H40F3N3O4S and a molecular weight of 571.71 g/mol. Its IUPAC name is tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59384428 |
| Molecular Formula | C28H40F3N3O4S |
| Molecular Weight | 571.71 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-octoxy-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCCCCCOc1ccc(-c2nnc([C@@]3(C)COC(C)(C)N3C(=O)OC(C)(C)C)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H40F3N3O4S/c1-8-9-10-11-12-13-16-36-21-15-14-19(17-20(21)28(29,30)31)22-32-33-23(39-22)27(7)18-37-26(5,6)34(27)24(35)38-25(2,3)4/h14-15,17H,8-13,16,18H2,1-7H3/t27-/m1/s1 |
| InChIKey | JIZPPOGARFLXAH-HHHXNRCGSA-N |
| XLogP | 8.18 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.71 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|