C24H34F3N3O3 — CID 143622499
2-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(4S)-2,2,3,4-tetramethyl-1,3-oxazolidin-4-yl]-1,3,4-oxadiazole (PubChem CID 143622499) has the molecular formula C24H34F3N3O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(4S)-2,2,3,4-tetramethyl-1,3-oxazolidin-4-yl]-1,3,4-oxadiazole.
| Compound Name | 2-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(4S)-2,2,3,4-tetramethyl-1,3-oxazolidin-4-yl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 143622499 |
| Molecular Formula | C24H34F3N3O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 2-[4-octoxy-3-(trifluoromethyl)phenyl]-5-[(4S)-2,2,3,4-tetramethyl-1,3-oxazolidin-4-yl]-1,3,4-oxadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2nnc([C@]3(C)COC(C)(C)N3C)o2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H34F3N3O3/c1-6-7-8-9-10-11-14-31-19-13-12-17(15-18(19)24(25,26)27)20-28-29-21(33-20)23(4)16-32-22(2,3)30(23)5/h12-13,15H,6-11,14,16H2,1-5H3/t23-/m0/s1 |
| InChIKey | JKZLAXGCSWNTEO-QHCPKHFHSA-N |
| XLogP | 6.41 |
| TPSA | 60.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|