C24H32F3N3O5S — CID 70928403
tert-butyl 4-[5-[4-(4-hydroxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 70928403) has the molecular formula C24H32F3N3O5S and a molecular weight of 531.60 g/mol. Its IUPAC name is tert-butyl 4-[5-[4-(4-hydroxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[5-[4-(4-hydroxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70928403 |
| Molecular Formula | C24H32F3N3O5S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | tert-butyl 4-[5-[4-(4-hydroxybutoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C)(C)OCC1(C)c1nnc(-c2ccc(OCCCCO)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C24H32F3N3O5S/c1-21(2,3)35-20(32)30-22(4,5)34-14-23(30,6)19-29-28-18(36-19)15-9-10-17(33-12-8-7-11-31)16(13-15)24(25,26)27/h9-10,13,31H,7-8,11-12,14H2,1-6H3 |
| InChIKey | FELHOAKEFUBJEG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 94.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|