C33H34F3N3O4S2 — CID 58014084
tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(3-phenylmethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 58014084) has the molecular formula C33H34F3N3O4S2 and a molecular weight of 657.78 g/mol. Its IUPAC name is tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(3-phenylmethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(3-phenylmethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 58014084 |
| Molecular Formula | C33H34F3N3O4S2 |
| Molecular Weight | 657.78 g/mol |
| Exact Mass | 657.19 |
| IUPAC Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(3-phenylmethoxyphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C)(C)OC[C@]1(C)c1nnc(-c2ccc(Sc3cccc(OCc4ccccc4)c3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C33H34F3N3O4S2/c1-30(2,3)43-29(40)39-31(4,5)42-20-32(39,6)28-38-37-27(45-28)22-15-16-26(25(17-22)33(34,35)36)44-24-14-10-13-23(18-24)41-19-21-11-8-7-9-12-21/h7-18H,19-20H2,1-6H3/t32-/m1/s1 |
| InChIKey | SHZXYQANFGRJQP-JGCGQSQUSA-N |
| XLogP | 9.17 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.78 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |