C32H37N3O6S — CID 70948153
tert-butyl 2,2,4-trimethyl-4-[[[4-(3-phenylmethoxyphenyl)sulfanylbenzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 70948153) has the molecular formula C32H37N3O6S and a molecular weight of 591.73 g/mol. Its IUPAC name is tert-butyl 2,2,4-trimethyl-4-[[[4-(3-phenylmethoxyphenyl)sulfanylbenzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 2,2,4-trimethyl-4-[[[4-(3-phenylmethoxyphenyl)sulfanylbenzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 70948153 |
| Molecular Formula | C32H37N3O6S |
| Molecular Weight | 591.73 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | tert-butyl 2,2,4-trimethyl-4-[[[4-(3-phenylmethoxyphenyl)sulfanylbenzoyl]amino]carbamoyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C)(C)OCC1(C)C(=O)NNC(=O)c1ccc(Sc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C32H37N3O6S/c1-30(2,3)41-29(38)35-31(4,5)40-21-32(35,6)28(37)34-33-27(36)23-15-17-25(18-16-23)42-26-14-10-13-24(19-26)39-20-22-11-8-7-9-12-22/h7-19H,20-21H2,1-6H3,(H,33,36)(H,34,37) |
| InChIKey | FOVFIDGJFCGRPK-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.73 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|