C29H46F3N3O7Si — CID 72529202
tert-butyl 4-[[[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 72529202) has the molecular formula C29H46F3N3O7Si and a molecular weight of 633.78 g/mol. Its IUPAC name is tert-butyl 4-[[[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl 4-[[[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 72529202 |
| Molecular Formula | C29H46F3N3O7Si |
| Molecular Weight | 633.78 g/mol |
| Exact Mass | 633.31 |
| IUPAC Name | tert-butyl 4-[[[4-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2,2,4-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C)(C)OCC1(C)C(=O)NNC(=O)c1ccc(OCCCO[Si](C)(C)C(C)(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H46F3N3O7Si/c1-25(2,3)42-24(38)35-27(7,8)40-18-28(35,9)23(37)34-33-22(36)19-13-14-21(20(17-19)29(30,31)32)39-15-12-16-41-43(10,11)26(4,5)6/h13-14,17H,12,15-16,18H2,1-11H3,(H,33,36)(H,34,37) |
| InChIKey | RTHKLVJXUCTINS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|