C29H42F3N3O6 — CID 89160344
tert-butyl (2R,4S)-4-methyl-4-[[[4-octoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2-prop-1-en-2-yl-1,3-oxazolidine-3-carboxylate (PubChem CID 89160344) has the molecular formula C29H42F3N3O6 and a molecular weight of 585.66 g/mol. Its IUPAC name is tert-butyl (2R,4S)-4-methyl-4-[[[4-octoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2-prop-1-en-2-yl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (2R,4S)-4-methyl-4-[[[4-octoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2-prop-1-en-2-yl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 89160344 |
| Molecular Formula | C29H42F3N3O6 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.30 |
| IUPAC Name | tert-butyl (2R,4S)-4-methyl-4-[[[4-octoxy-3-(trifluoromethyl)benzoyl]amino]carbamoyl]-2-prop-1-en-2-yl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C(C)[C@H]1OC[C@@](C)(C(=O)NNC(=O)c2ccc(OCCCCCCCC)c(C(F)(F)F)c2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H42F3N3O6/c1-8-9-10-11-12-13-16-39-22-15-14-20(17-21(22)29(30,31)32)23(36)33-34-25(37)28(7)18-40-24(19(2)3)35(28)26(38)41-27(4,5)6/h14-15,17,24H,2,8-13,16,18H2,1,3-7H3,(H,33,36)(H,34,37)/t24-,28+/m1/s1 |
| InChIKey | HNWKZLMUWZJLAA-YWEHKCAJSA-N |
| XLogP | 6.13 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|