C31H38F3N3O4S — CID 59384398
tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate (PubChem CID 59384398) has the molecular formula C31H38F3N3O4S and a molecular weight of 605.72 g/mol. Its IUPAC name is tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 59384398 |
| Molecular Formula | C31H38F3N3O4S |
| Molecular Weight | 605.72 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | tert-butyl (4R)-2,2,4-trimethyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(C)(C)OC[C@]1(C)c1nnc(-c2ccc(OCCCCCc3ccccc3)c(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C31H38F3N3O4S/c1-28(2,3)41-27(38)37-29(4,5)40-20-30(37,6)26-36-35-25(42-26)22-16-17-24(23(19-22)31(32,33)34)39-18-12-8-11-15-21-13-9-7-10-14-21/h7,9-10,13-14,16-17,19H,8,11-12,15,18,20H2,1-6H3/t30-/m1/s1 |
| InChIKey | JYZFWEXDKVFBDD-SSEXGKCCSA-N |
| XLogP | 8.23 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.72 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|