C27H28F3N3O3S — CID 71132071
(4S)-4-amino-1-methyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]cyclopent-2-ene-1-carboxylic acid (PubChem CID 71132071) has the molecular formula C27H28F3N3O3S and a molecular weight of 531.60 g/mol. Its IUPAC name is (4S)-4-amino-1-methyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]cyclopent-2-ene-1-carboxylic acid.
| Compound Name | (4S)-4-amino-1-methyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]cyclopent-2-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 71132071 |
| Molecular Formula | C27H28F3N3O3S |
| Molecular Weight | 531.60 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | (4S)-4-amino-1-methyl-4-[5-[4-(5-phenylpentoxy)-3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]cyclopent-2-ene-1-carboxylic acid |
| SMILES | CC1(C(=O)O)C=C[C@](N)(c2nnc(-c3ccc(OCCCCCc4ccccc4)c(C(F)(F)F)c3)s2)C1 |
| InChI | InChI=1S/C27H28F3N3O3S/c1-25(24(34)35)13-14-26(31,17-25)23-33-32-22(37-23)19-11-12-21(20(16-19)27(28,29)30)36-15-7-3-6-10-18-8-4-2-5-9-18/h2,4-5,8-9,11-14,16H,3,6-7,10,15,17,31H2,1H3,(H,34,35)/t25?,26-/m1/s1 |
| InChIKey | WEIRXWDNMMLZHP-FXDYGKIASA-N |
| XLogP | 6.22 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|