C30H16F6N4O9 — CID 157214447
1-(2-hydroxy-3-nitrophenyl)-3-[2-(trifluoromethyl)-3-pyridinyl]propane-1,3-dione;8-nitro-2-[2-(trifluoromethyl)-3-pyridinyl]chromen-4-one (PubChem CID 157214447) has the molecular formula C30H16F6N4O9 and a molecular weight of 690.47 g/mol. Its IUPAC name is 1-(2-hydroxy-3-nitrophenyl)-3-[2-(trifluoromethyl)-3-pyridinyl]propane-1,3-dione;8-nitro-2-[2-(trifluoromethyl)-3-pyridinyl]chromen-4-one.
| Compound Name | 1-(2-hydroxy-3-nitrophenyl)-3-[2-(trifluoromethyl)-3-pyridinyl]propane-1,3-dione;8-nitro-2-[2-(trifluoromethyl)-3-pyridinyl]chromen-4-one |
|---|---|
| PubChem CID | 157214447 |
| Molecular Formula | C30H16F6N4O9 |
| Molecular Weight | 690.47 g/mol |
| Exact Mass | 690.08 |
| IUPAC Name | 1-(2-hydroxy-3-nitrophenyl)-3-[2-(trifluoromethyl)-3-pyridinyl]propane-1,3-dione;8-nitro-2-[2-(trifluoromethyl)-3-pyridinyl]chromen-4-one |
| SMILES | O=C(CC(=O)c1cccc([N+](=O)[O-])c1O)c1cccnc1C(F)(F)F.O=c1cc(-c2cccnc2C(F)(F)F)oc2c([N+](=O)[O-])cccc12 |
| InChI | InChI=1S/C15H9F3N2O5.C15H7F3N2O4/c16-15(17,18)14-9(4-2-6-19-14)12(22)7-11(21)8-3-1-5-10(13(8)23)20(24)25;16-15(17,18)14-9(4-2-6-19-14)12-7-11(21)8-3-1-5-10(20(22)23)13(8)24-12/h1-6,23H,7H2;1-7H |
| InChIKey | ASGHZUIPPPIDCY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 196.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.47 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|