C16H13F3N4O6 — CID 67037177
N'-(3,4-dimethoxy-5-nitrobenzoyl)-2-(trifluoromethyl)pyridine-3-carbohydrazide (PubChem CID 67037177) has the molecular formula C16H13F3N4O6 and a molecular weight of 414.30 g/mol. Its IUPAC name is N'-(3,4-dimethoxy-5-nitrobenzoyl)-2-(trifluoromethyl)pyridine-3-carbohydrazide.
| Compound Name | N'-(3,4-dimethoxy-5-nitrobenzoyl)-2-(trifluoromethyl)pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 67037177 |
| Molecular Formula | C16H13F3N4O6 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | N'-(3,4-dimethoxy-5-nitrobenzoyl)-2-(trifluoromethyl)pyridine-3-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cccnc2C(F)(F)F)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C16H13F3N4O6/c1-28-11-7-8(6-10(23(26)27)12(11)29-2)14(24)21-22-15(25)9-4-3-5-20-13(9)16(17,18)19/h3-7H,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | KYHYYRZPPAHKGZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|