C13H18BrClN2O2 — CID 157217260
tert-butyl (2S)-2-(5-bromo-4-chloro-3H-pyrrol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 157217260) has the molecular formula C13H18BrClN2O2 and a molecular weight of 349.66 g/mol. Its IUPAC name is tert-butyl (2S)-2-(5-bromo-4-chloro-3H-pyrrol-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(5-bromo-4-chloro-3H-pyrrol-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157217260 |
| Molecular Formula | C13H18BrClN2O2 |
| Molecular Weight | 349.66 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | tert-butyl (2S)-2-(5-bromo-4-chloro-3H-pyrrol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C1=NC(Br)=C(Cl)C1 |
| InChI | InChI=1S/C13H18BrClN2O2/c1-13(2,3)19-12(18)17-6-4-5-10(17)9-7-8(15)11(14)16-9/h10H,4-7H2,1-3H3/t10-/m0/s1 |
| InChIKey | XYUFYGHURBVJST-JTQLQIEISA-N |
| XLogP | 4.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.66 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|