C36H26Br2N4O2 — CID 157220969
8-aminoquinoline-7-carbaldehyde;1-(4-bromophenyl)ethanone;2-(4-bromophenyl)-1,10-phenanthroline (PubChem CID 157220969) has the molecular formula C36H26Br2N4O2 and a molecular weight of 706.44 g/mol. Its IUPAC name is 8-aminoquinoline-7-carbaldehyde;1-(4-bromophenyl)ethanone;2-(4-bromophenyl)-1,10-phenanthroline.
| Compound Name | 8-aminoquinoline-7-carbaldehyde;1-(4-bromophenyl)ethanone;2-(4-bromophenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 157220969 |
| Molecular Formula | C36H26Br2N4O2 |
| Molecular Weight | 706.44 g/mol |
| Exact Mass | 704.04 |
| IUPAC Name | 8-aminoquinoline-7-carbaldehyde;1-(4-bromophenyl)ethanone;2-(4-bromophenyl)-1,10-phenanthroline |
| SMILES | Brc1ccc(-c2ccc3ccc4cccnc4c3n2)cc1.CC(=O)c1ccc(Br)cc1.Nc1c(C=O)ccc2cccnc12 |
| InChI | InChI=1S/C18H11BrN2.C10H8N2O.C8H7BrO/c19-15-8-5-12(6-9-15)16-10-7-14-4-3-13-2-1-11-20-17(13)18(14)21-16;11-9-8(6-13)4-3-7-2-1-5-12-10(7)9;1-6(10)7-2-4-8(9)5-3-7/h1-11H;1-6H,11H2;2-5H,1H3 |
| InChIKey | ASZHGPIGQFSAKS-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.44 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|