C30H48N2O9 — CID 157227939
N-[[2-(3-oxopent-4-enoxymethyl)-2-[[2-(3-oxopent-4-enoxymethyl)-2-[(prop-2-enoylamino)methoxymethyl]butoxy]methyl]butoxy]methyl]prop-2-enamide (PubChem CID 157227939) has the molecular formula C30H48N2O9 and a molecular weight of 580.72 g/mol. Its IUPAC name is N-[[2-(3-oxopent-4-enoxymethyl)-2-[[2-(3-oxopent-4-enoxymethyl)-2-[(prop-2-enoylamino)methoxymethyl]butoxy]methyl]butoxy]methyl]prop-2-enamide.
| Compound Name | N-[[2-(3-oxopent-4-enoxymethyl)-2-[[2-(3-oxopent-4-enoxymethyl)-2-[(prop-2-enoylamino)methoxymethyl]butoxy]methyl]butoxy]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 157227939 |
| Molecular Formula | C30H48N2O9 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | N-[[2-(3-oxopent-4-enoxymethyl)-2-[[2-(3-oxopent-4-enoxymethyl)-2-[(prop-2-enoylamino)methoxymethyl]butoxy]methyl]butoxy]methyl]prop-2-enamide |
| SMILES | C=CC(=O)CCOCC(CC)(COCNC(=O)C=C)COCC(CC)(COCCC(=O)C=C)COCNC(=O)C=C |
| InChI | InChI=1S/C30H48N2O9/c1-7-25(33)13-15-37-17-29(11-5,21-40-23-31-27(35)9-3)19-39-20-30(12-6,18-38-16-14-26(34)8-2)22-41-24-32-28(36)10-4/h7-10H,1-4,11-24H2,5-6H3,(H,31,35)(H,32,36) |
| InChIKey | ATTLGAXWTRXYNK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 138.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|