C33H46N4O8 — CID 157232816
(3S,6S,9R,12R)-3-butan-2-yl-6-[2-(2-nitrophenyl)-2-oxoethyl]-9-(6-oxooctyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone (PubChem CID 157232816) has the molecular formula C33H46N4O8 and a molecular weight of 626.75 g/mol. Its IUPAC name is (3S,6S,9R,12R)-3-butan-2-yl-6-[2-(2-nitrophenyl)-2-oxoethyl]-9-(6-oxooctyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9R,12R)-3-butan-2-yl-6-[2-(2-nitrophenyl)-2-oxoethyl]-9-(6-oxooctyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 157232816 |
| Molecular Formula | C33H46N4O8 |
| Molecular Weight | 626.75 g/mol |
| Exact Mass | 626.33 |
| IUPAC Name | (3S,6S,9R,12R)-3-butan-2-yl-6-[2-(2-nitrophenyl)-2-oxoethyl]-9-(6-oxooctyl)-1,4,7-triazabicyclo[10.4.0]hexadecane-2,5,8,11-tetrone |
| SMILES | CCC(=O)CCCCC[C@@H]1CC(=O)[C@H]2CCCCN2C(=O)[C@H](C(C)CC)NC(=O)[C@H](CC(=O)c2ccccc2[N+](=O)[O-])NC1=O |
| InChI | InChI=1S/C33H46N4O8/c1-4-21(3)30-33(43)36-18-12-11-17-27(36)29(40)19-22(13-7-6-8-14-23(38)5-2)31(41)34-25(32(42)35-30)20-28(39)24-15-9-10-16-26(24)37(44)45/h9-10,15-16,21-22,25,27,30H,4-8,11-14,17-20H2,1-3H3,(H,34,41)(H,35,42)/t21?,22-,25+,27-,30+/m1/s1 |
| InChIKey | YILANSJFVIDOIN-DUGJXZQPSA-N |
| XLogP | 4.08 |
| TPSA | 172.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.75 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|