C20H23N3OS — CID 15723315
ethyl N-(C,N-diphenylcarbonimidoyl)morpholine-4-carboximidothioate (PubChem CID 15723315) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is ethyl N-(C,N-diphenylcarbonimidoyl)morpholine-4-carboximidothioate.
| Compound Name | ethyl N-(C,N-diphenylcarbonimidoyl)morpholine-4-carboximidothioate |
|---|---|
| PubChem CID | 15723315 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | ethyl N-(C,N-diphenylcarbonimidoyl)morpholine-4-carboximidothioate |
| SMILES | CCS/C(=N\C(=N/c1ccccc1)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C20H23N3OS/c1-2-25-20(23-13-15-24-16-14-23)22-19(17-9-5-3-6-10-17)21-18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3/b21-19-,22-20- |
| InChIKey | LBNFCNUPJADDEE-WRBBJXAJSA-N |
| XLogP | 4.21 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|