C22H32O5S — CID 157239159
methyl (2R,4R,5R)-6-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 157239159) has the molecular formula C22H32O5S and a molecular weight of 408.56 g/mol. Its IUPAC name is methyl (2R,4R,5R)-6-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4R,5R)-6-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 157239159 |
| Molecular Formula | C22H32O5S |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | methyl (2R,4R,5R)-6-[(1S)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-dimethyl-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@@H](C)[C@@H](C)C([C@H](C)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C22H32O5S/c1-14-12-22(20(23)24-6,28-17-10-8-7-9-11-17)27-19(15(14)2)16(3)18-13-25-21(4,5)26-18/h7-11,14-16,18-19H,12-13H2,1-6H3/t14-,15-,16-,18-,19?,22-/m1/s1 |
| InChIKey | JFUGJMSXHQSSQZ-WVFCFQIMSA-N |
| XLogP | 4.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |