C25H22ClN5O3 — CID 157251183
6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]-7-methoxyquinazolin-4-amine (PubChem CID 157251183) has the molecular formula C25H22ClN5O3 and a molecular weight of 475.94 g/mol. Its IUPAC name is 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 157251183 |
| Molecular Formula | C25H22ClN5O3 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | 6-(1-buta-1,3-dien-2-ylazetidin-3-yl)oxy-N-[4-chloro-3-(1,3-oxazol-5-yl)phenyl]-7-methoxyquinazolin-4-amine |
| SMILES | C=CC(=C)N1CC(Oc2cc3c(Nc4ccc(Cl)c(-c5cnco5)c4)ncnc3cc2OC)C1 |
| InChI | InChI=1S/C25H22ClN5O3/c1-4-15(2)31-11-17(12-31)34-23-8-19-21(9-22(23)32-3)28-13-29-25(19)30-16-5-6-20(26)18(7-16)24-10-27-14-33-24/h4-10,13-14,17H,1-2,11-12H2,3H3,(H,28,29,30) |
| InChIKey | NVYITQWSHJXMJA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 85.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|