C24H24Cl2N4O2 — CID 157290356
6-(1-buta-1,3-dien-2-ylpiperidin-4-yl)oxy-N-(2,4-dichlorophenyl)-7-methoxyquinazolin-4-amine (PubChem CID 157290356) has the molecular formula C24H24Cl2N4O2 and a molecular weight of 471.39 g/mol. Its IUPAC name is 6-(1-buta-1,3-dien-2-ylpiperidin-4-yl)oxy-N-(2,4-dichlorophenyl)-7-methoxyquinazolin-4-amine.
| Compound Name | 6-(1-buta-1,3-dien-2-ylpiperidin-4-yl)oxy-N-(2,4-dichlorophenyl)-7-methoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 157290356 |
| Molecular Formula | C24H24Cl2N4O2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 6-(1-buta-1,3-dien-2-ylpiperidin-4-yl)oxy-N-(2,4-dichlorophenyl)-7-methoxyquinazolin-4-amine |
| SMILES | C=CC(=C)N1CCC(Oc2cc3c(Nc4ccc(Cl)cc4Cl)ncnc3cc2OC)CC1 |
| InChI | InChI=1S/C24H24Cl2N4O2/c1-4-15(2)30-9-7-17(8-10-30)32-23-12-18-21(13-22(23)31-3)27-14-28-24(18)29-20-6-5-16(25)11-19(20)26/h4-6,11-14,17H,1-2,7-10H2,3H3,(H,27,28,29) |
| InChIKey | AYHKNFUZQXXRRJ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|