C9H15N5 — CID 157260454
1-cyclopenta-1,4-dien-1-yl-1-methyl-2-(N'-methylcarbamimidoyl)guanidine (PubChem CID 157260454) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-cyclopenta-1,4-dien-1-yl-1-methyl-2-(N'-methylcarbamimidoyl)guanidine.
| Compound Name | 1-cyclopenta-1,4-dien-1-yl-1-methyl-2-(N'-methylcarbamimidoyl)guanidine |
|---|---|
| PubChem CID | 157260454 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-cyclopenta-1,4-dien-1-yl-1-methyl-2-(N'-methylcarbamimidoyl)guanidine |
| SMILES | C/N=C(\N)N=C(N)N(C)C1=CCC=C1 |
| InChI | InChI=1S/C9H15N5/c1-12-8(10)13-9(11)14(2)7-5-3-4-6-7/h3,5-6H,4H2,1-2H3,(H4,10,11,12,13) |
| InChIKey | FSRNPJIFJUSTQU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|