C31H31ClFN3O2 — CID 157274624
1-(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-[2-(4-fluorophenyl)acetyl]piperidin-1-yl]phenyl]propan-1-one (PubChem CID 157274624) has the molecular formula C31H31ClFN3O2 and a molecular weight of 532.06 g/mol. Its IUPAC name is 1-(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-[2-(4-fluorophenyl)acetyl]piperidin-1-yl]phenyl]propan-1-one.
| Compound Name | 1-(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-[2-(4-fluorophenyl)acetyl]piperidin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 157274624 |
| Molecular Formula | C31H31ClFN3O2 |
| Molecular Weight | 532.06 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | 1-(6-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-[2-(4-fluorophenyl)acetyl]piperidin-1-yl]phenyl]propan-1-one |
| SMILES | CCc1nc2ccc(Cl)cn2c1C(=O)CCc1ccc(N2CCC(C(=O)Cc3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H31ClFN3O2/c1-2-27-31(36-20-24(32)8-14-30(36)34-27)28(37)13-7-21-5-11-26(12-6-21)35-17-15-23(16-18-35)29(38)19-22-3-9-25(33)10-4-22/h3-6,8-12,14,20,23H,2,7,13,15-19H2,1H3 |
| InChIKey | AYYIKHUTDPWCIF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 54.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.06 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|