C21H20ClFN3O6PS — CID 157283939
1-[3-amino-6-(2-chloro-5-fluorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone (PubChem CID 157283939) has the molecular formula C21H20ClFN3O6PS and a molecular weight of 527.90 g/mol. Its IUPAC name is 1-[3-amino-6-(2-chloro-5-fluorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone.
| Compound Name | 1-[3-amino-6-(2-chloro-5-fluorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
|---|---|
| PubChem CID | 157283939 |
| Molecular Formula | C21H20ClFN3O6PS |
| Molecular Weight | 527.90 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 1-[3-amino-6-(2-chloro-5-fluorophenyl)pyrazin-2-yl]-2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]ethanone |
| SMILES | COP(=O)(CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3cc(F)ccc3Cl)cnc2N)cc1)OC |
| InChI | InChI=1S/C21H20ClFN3O6PS/c1-31-33(28,32-2)12-34(29,30)15-6-3-13(4-7-15)9-19(27)20-21(24)25-11-18(26-20)16-10-14(23)5-8-17(16)22/h3-8,10-11H,9,12H2,1-2H3,(H2,24,25) |
| InChIKey | TXEPACHKLQHMHW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 138.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.90 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|