C29H35FN2O2 — CID 157291455
(2S)-6-(dibenzylamino)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxyhexanamide (PubChem CID 157291455) has the molecular formula C29H35FN2O2 and a molecular weight of 462.61 g/mol. Its IUPAC name is (2S)-6-(dibenzylamino)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxyhexanamide.
| Compound Name | (2S)-6-(dibenzylamino)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 157291455 |
| Molecular Formula | C29H35FN2O2 |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | (2S)-6-(dibenzylamino)-2-[(4-fluoro-3,5-dimethylphenyl)methyl]-N-hydroxyhexanamide |
| SMILES | Cc1cc(C[C@H](CCCCN(Cc2ccccc2)Cc2ccccc2)C(=O)NO)cc(C)c1F |
| InChI | InChI=1S/C29H35FN2O2/c1-22-17-26(18-23(2)28(22)30)19-27(29(33)31-34)15-9-10-16-32(20-24-11-5-3-6-12-24)21-25-13-7-4-8-14-25/h3-8,11-14,17-18,27,34H,9-10,15-16,19-21H2,1-2H3,(H,31,33)/t27-/m0/s1 |
| InChIKey | BAVVUXKLMMHBFH-MHZLTWQESA-N |
| XLogP | 5.98 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|