C24H34FN3O2 — CID 165004511
(2S)-6-[2-(5-fluoro-2-pyridinyl)propan-2-ylamino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide (PubChem CID 165004511) has the molecular formula C24H34FN3O2 and a molecular weight of 415.55 g/mol. Its IUPAC name is (2S)-6-[2-(5-fluoro-2-pyridinyl)propan-2-ylamino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide.
| Compound Name | (2S)-6-[2-(5-fluoro-2-pyridinyl)propan-2-ylamino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide |
|---|---|
| PubChem CID | 165004511 |
| Molecular Formula | C24H34FN3O2 |
| Molecular Weight | 415.55 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | (2S)-6-[2-(5-fluoro-2-pyridinyl)propan-2-ylamino]-N-hydroxy-2-[(3,4,5-trimethylphenyl)methyl]hexanamide |
| SMILES | Cc1cc(C[C@H](CCCCNC(C)(C)c2ccc(F)cn2)C(=O)NO)cc(C)c1C |
| InChI | InChI=1S/C24H34FN3O2/c1-16-12-19(13-17(2)18(16)3)14-20(23(29)28-30)8-6-7-11-27-24(4,5)22-10-9-21(25)15-26-22/h9-10,12-13,15,20,27,30H,6-8,11,14H2,1-5H3,(H,28,29)/t20-/m0/s1 |
| InChIKey | YCYZHATXBJQTKJ-FQEVSTJZSA-N |
| XLogP | 4.51 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|