C37H24F2N4O8S2 — CID 157298501
5-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate (PubChem CID 157298501) has the molecular formula C37H24F2N4O8S2 and a molecular weight of 754.75 g/mol. Its IUPAC name is 5-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate.
| Compound Name | 5-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate |
|---|---|
| PubChem CID | 157298501 |
| Molecular Formula | C37H24F2N4O8S2 |
| Molecular Weight | 754.75 g/mol |
| Exact Mass | 754.10 |
| IUPAC Name | 5-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate |
| SMILES | COC(=O)c1cc(C(N)=S)ccc1-c1ccccc1[N+](=O)[O-].O=C(O)c1cc(-c2nc(-c3cc(F)cc(F)c3)cs2)ccc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H12F2N2O4S.C15H12N2O4S/c23-14-7-13(8-15(24)10-14)19-11-31-21(25-19)12-5-6-16(18(9-12)22(27)28)17-3-1-2-4-20(17)26(29)30;1-21-15(18)12-8-9(14(16)22)6-7-10(12)11-4-2-3-5-13(11)17(19)20/h1-11H,(H,27,28);2-8H,1H3,(H2,16,22) |
| InChIKey | BBPTWYOLCVXKDU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 188.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.75 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|