About [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate
[2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate (PubChem CID 118451016) has the molecular formula C23H13F3N2O5S
and a molecular weight of 486.43 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
| PubChem CID | 118451016 |
| Molecular Formula | C23H13F3N2O5S |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2nc(-c3cccc(C(F)(F)F)c3)cs2)ccc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H13F3N2O5S/c24-23(25,26)15-5-3-4-13(10-15)18-12-34-21(27-18)14-8-9-17(20(11-14)33-22(29)30)16-6-1-2-7-19(16)28(31)32/h1-12H,(H,29,30) |
| InChIKey | IESXHGZCFXCACX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate?
The IUPAC name of [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate (CID 118451016) is [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate.
What is the SMILES notation for [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate?
The canonical SMILES for [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate is O=C(O)Oc1cc(-c2nc(-c3cccc(C(F)(F)F)c3)cs2)ccc1-c1ccccc1[N+](=O)[O-].
What is the InChIKey of [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate?
The InChIKey is IESXHGZCFXCACX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H13F3N2O5S/c24-23(25,26)15-5-3-4-13(10-15)18-12-34-21(27-18)14-8-9-17(20(11-14)33-22(29)30)16-6-1-2-7-19(16)28(31)32/h1-12H,(H,29,30).
What are the key properties of [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate?
[2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate has a molecular weight of 486.43 g/mol, XLogP of 7.13, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate is sourced from PubChem (CID 118451016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).