C23H13F3N2O5S — CID 118451016
[2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate (PubChem CID 118451016) has the molecular formula C23H13F3N2O5S and a molecular weight of 486.43 g/mol. Its IUPAC name is [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate.
| Compound Name | [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118451016 |
| Molecular Formula | C23H13F3N2O5S |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | [2-(2-nitrophenyl)-5-[4-[3-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2nc(-c3cccc(C(F)(F)F)c3)cs2)ccc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H13F3N2O5S/c24-23(25,26)15-5-3-4-13(10-15)18-12-34-21(27-18)14-8-9-17(20(11-14)33-22(29)30)16-6-1-2-7-19(16)28(31)32/h1-12H,(H,29,30) |
| InChIKey | IESXHGZCFXCACX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 102.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|