C23H14Cl3NO3S — CID 118450962
[2-(2-chloro-5-methylphenyl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl] hydrogen carbonate (PubChem CID 118450962) has the molecular formula C23H14Cl3NO3S and a molecular weight of 490.80 g/mol. Its IUPAC name is [2-(2-chloro-5-methylphenyl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl] hydrogen carbonate.
| Compound Name | [2-(2-chloro-5-methylphenyl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118450962 |
| Molecular Formula | C23H14Cl3NO3S |
| Molecular Weight | 490.80 g/mol |
| Exact Mass | 488.98 |
| IUPAC Name | [2-(2-chloro-5-methylphenyl)-5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]phenyl] hydrogen carbonate |
| SMILES | Cc1ccc(Cl)c(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2OC(=O)O)c1 |
| InChI | InChI=1S/C23H14Cl3NO3S/c1-12-2-6-17(24)16(8-12)15-5-3-14(10-21(15)30-23(28)29)22-27-20(11-31-22)13-4-7-18(25)19(26)9-13/h2-11H,1H3,(H,28,29) |
| InChIKey | SOPRDELWETVFDV-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|