C27H23Cl2N3O4S — CID 118451009
[5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 118451009) has the molecular formula C27H23Cl2N3O4S and a molecular weight of 556.47 g/mol. Its IUPAC name is [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118451009 |
| Molecular Formula | C27H23Cl2N3O4S |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[2-(dimethylamino)ethylcarbamoyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CN(C)CCNC(=O)c1ccc(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2OC(=O)O)cc1 |
| InChI | InChI=1S/C27H23Cl2N3O4S/c1-32(2)12-11-30-25(33)17-5-3-16(4-6-17)20-9-7-19(14-24(20)36-27(34)35)26-31-23(15-37-26)18-8-10-21(28)22(29)13-18/h3-10,13-15H,11-12H2,1-2H3,(H,30,33)(H,34,35) |
| InChIKey | QYSDJQBUULCDCD-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|