C23H15Cl2NO4S — CID 118450958
[5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(3-methoxyphenyl)phenyl] hydrogen carbonate (PubChem CID 118450958) has the molecular formula C23H15Cl2NO4S and a molecular weight of 472.35 g/mol. Its IUPAC name is [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(3-methoxyphenyl)phenyl] hydrogen carbonate.
| Compound Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(3-methoxyphenyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118450958 |
| Molecular Formula | C23H15Cl2NO4S |
| Molecular Weight | 472.35 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-(3-methoxyphenyl)phenyl] hydrogen carbonate |
| SMILES | COc1cccc(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2OC(=O)O)c1 |
| InChI | InChI=1S/C23H15Cl2NO4S/c1-29-16-4-2-3-13(9-16)17-7-5-15(11-21(17)30-23(27)28)22-26-20(12-31-22)14-6-8-18(24)19(25)10-14/h2-12H,1H3,(H,27,28) |
| InChIKey | OLOYUAXOTTWVKU-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.35 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|