C28H25Cl2N3O4S — CID 118451051
[5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[3-(dimethylamino)propylcarbamoyl]phenyl]phenyl] hydrogen carbonate (PubChem CID 118451051) has the molecular formula C28H25Cl2N3O4S and a molecular weight of 570.50 g/mol. Its IUPAC name is [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[3-(dimethylamino)propylcarbamoyl]phenyl]phenyl] hydrogen carbonate.
| Compound Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[3-(dimethylamino)propylcarbamoyl]phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118451051 |
| Molecular Formula | C28H25Cl2N3O4S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-[3-(dimethylamino)propylcarbamoyl]phenyl]phenyl] hydrogen carbonate |
| SMILES | CN(C)CCCNC(=O)c1ccc(-c2ccc(-c3nc(-c4ccc(Cl)c(Cl)c4)cs3)cc2OC(=O)O)cc1 |
| InChI | InChI=1S/C28H25Cl2N3O4S/c1-33(2)13-3-12-31-26(34)18-6-4-17(5-7-18)21-10-8-20(15-25(21)37-28(35)36)27-32-24(16-38-27)19-9-11-22(29)23(30)14-19/h4-11,14-16H,3,12-13H2,1-2H3,(H,31,34)(H,35,36) |
| InChIKey | HLTCOXCLLLDYOX-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|