C28H18Cl2N2O4S2 — CID 118450985
[5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(thiophen-2-ylmethylcarbamoyl)phenyl]phenyl] hydrogen carbonate (PubChem CID 118450985) has the molecular formula C28H18Cl2N2O4S2 and a molecular weight of 581.50 g/mol. Its IUPAC name is [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(thiophen-2-ylmethylcarbamoyl)phenyl]phenyl] hydrogen carbonate.
| Compound Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(thiophen-2-ylmethylcarbamoyl)phenyl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 118450985 |
| Molecular Formula | C28H18Cl2N2O4S2 |
| Molecular Weight | 581.50 g/mol |
| Exact Mass | 580.01 |
| IUPAC Name | [5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-[4-(thiophen-2-ylmethylcarbamoyl)phenyl]phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)ccc1-c1ccc(C(=O)NCc2cccs2)cc1 |
| InChI | InChI=1S/C28H18Cl2N2O4S2/c29-22-10-8-18(12-23(22)30)24-15-38-27(32-24)19-7-9-21(25(13-19)36-28(34)35)16-3-5-17(6-4-16)26(33)31-14-20-2-1-11-37-20/h1-13,15H,14H2,(H,31,33)(H,34,35) |
| InChIKey | ACRNYCKFNHCNPH-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.50 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|