C37H25BrN4O8S2 — CID 159677455
5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate (PubChem CID 159677455) has the molecular formula C37H25BrN4O8S2 and a molecular weight of 797.67 g/mol. Its IUPAC name is 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate.
| Compound Name | 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate |
|---|---|
| PubChem CID | 159677455 |
| Molecular Formula | C37H25BrN4O8S2 |
| Molecular Weight | 797.67 g/mol |
| Exact Mass | 796.03 |
| IUPAC Name | 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-(2-nitrophenyl)benzoic acid;methyl 5-carbamothioyl-2-(2-nitrophenyl)benzoate |
| SMILES | COC(=O)c1cc(C(N)=S)ccc1-c1ccccc1[N+](=O)[O-].O=C(O)c1cc(-c2nc(-c3ccc(Br)cc3)cs2)ccc1-c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H13BrN2O4S.C15H12N2O4S/c23-15-8-5-13(6-9-15)19-12-30-21(24-19)14-7-10-16(18(11-14)22(26)27)17-3-1-2-4-20(17)25(28)29;1-21-15(18)12-8-9(14(16)22)6-7-10(12)11-4-2-3-5-13(11)17(19)20/h1-12H,(H,26,27);2-8H,1H3,(H2,16,22) |
| InChIKey | MUUAVWCSJCBZFI-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 188.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.67 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|