C16H16FNO — CID 157307258
[2-(cyclopenten-1-yl)-4-fluorophenyl]-(3H-pyrrol-2-yl)methanol (PubChem CID 157307258) has the molecular formula C16H16FNO and a molecular weight of 257.31 g/mol. Its IUPAC name is [2-(cyclopenten-1-yl)-4-fluorophenyl]-(3H-pyrrol-2-yl)methanol.
| Compound Name | [2-(cyclopenten-1-yl)-4-fluorophenyl]-(3H-pyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 157307258 |
| Molecular Formula | C16H16FNO |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | [2-(cyclopenten-1-yl)-4-fluorophenyl]-(3H-pyrrol-2-yl)methanol |
| SMILES | OC(C1=NC=CC1)c1ccc(F)cc1C1=CCCC1 |
| InChI | InChI=1S/C16H16FNO/c17-12-7-8-13(16(19)15-6-3-9-18-15)14(10-12)11-4-1-2-5-11/h3-4,7-10,16,19H,1-2,5-6H2 |
| InChIKey | BCPYUZZGOGUDAN-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |