C4H5Cl2N3S — CID 157313681
4,5-dichloro-1H-imidazole;methanethioamide (PubChem CID 157313681) has the molecular formula C4H5Cl2N3S and a molecular weight of 198.08 g/mol. Its IUPAC name is 4,5-dichloro-1H-imidazole;methanethioamide.
| Compound Name | 4,5-dichloro-1H-imidazole;methanethioamide |
|---|---|
| PubChem CID | 157313681 |
| Molecular Formula | C4H5Cl2N3S |
| Molecular Weight | 198.08 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 4,5-dichloro-1H-imidazole;methanethioamide |
| SMILES | Clc1nc[nH]c1Cl.NC=S |
| InChI | InChI=1S/C3H2Cl2N2.CH3NS/c4-2-3(5)7-1-6-2;2-1-3/h1H,(H,6,7);1H,(H2,2,3) |
| InChIKey | BDILGQKSKJMOTM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.08 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|