C30H24IN11S2 — CID 157318224
2-N-[2-[[2-[[4-amino-6-(5-iodo-2-pyridinyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 157318224) has the molecular formula C30H24IN11S2 and a molecular weight of 729.64 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-(5-iodo-2-pyridinyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-(5-iodo-2-pyridinyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 157318224 |
| Molecular Formula | C30H24IN11S2 |
| Molecular Weight | 729.64 g/mol |
| Exact Mass | 729.07 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-(5-iodo-2-pyridinyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(4-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(Nc3ccccc3SSc3ccccc3Nc3nc(N)nc(-c4ccc(I)cn4)n3)n2)cc1 |
| InChI | InChI=1S/C30H24IN11S2/c1-17-10-12-18(13-11-17)25-37-27(32)41-29(39-25)35-20-6-2-4-8-23(20)43-44-24-9-5-3-7-21(24)36-30-40-26(38-28(33)42-30)22-15-14-19(31)16-34-22/h2-16H,1H3,(H3,32,35,37,39,41)(H3,33,36,38,40,42) |
| InChIKey | VLQZQNNKDWRVLR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 166.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.64 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|