C26H33ClN8O3 — CID 157319056
1-N-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)-4-N-[2-(diethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine;methane (PubChem CID 157319056) has the molecular formula C26H33ClN8O3 and a molecular weight of 541.06 g/mol. Its IUPAC name is 1-N-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)-4-N-[2-(diethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine;methane.
| Compound Name | 1-N-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)-4-N-[2-(diethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine;methane |
|---|---|
| PubChem CID | 157319056 |
| Molecular Formula | C26H33ClN8O3 |
| Molecular Weight | 541.06 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 1-N-(5-chloro-4-pyrazolo[1,5-a]pyridin-3-ylpyrimidin-2-yl)-4-N-[2-(diethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine;methane |
| SMILES | C.CCN(CC)CCN(C)c1cc(OC)c(Nc2ncc(Cl)c(-c3cnn4ccccc34)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H29ClN8O3.CH4/c1-5-32(6-2)12-11-31(3)21-14-23(37-4)19(13-22(21)34(35)36)29-25-27-16-18(26)24(30-25)17-15-28-33-10-8-7-9-20(17)33;/h7-10,13-16H,5-6,11-12H2,1-4H3,(H,27,29,30);1H4 |
| InChIKey | BDYHWOUIVLLEAX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.06 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|