C27H30ClN9O3 — CID 140816847
1-N-[5-chloro-4-(5-isocyano-3-propylindazol-1-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine (PubChem CID 140816847) has the molecular formula C27H30ClN9O3 and a molecular weight of 564.05 g/mol. Its IUPAC name is 1-N-[5-chloro-4-(5-isocyano-3-propylindazol-1-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine.
| Compound Name | 1-N-[5-chloro-4-(5-isocyano-3-propylindazol-1-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
|---|---|
| PubChem CID | 140816847 |
| Molecular Formula | C27H30ClN9O3 |
| Molecular Weight | 564.05 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 1-N-[5-chloro-4-(5-isocyano-3-propylindazol-1-yl)pyrimidin-2-yl]-4-N-[2-(dimethylamino)ethyl]-2-methoxy-4-N-methyl-5-nitrobenzene-1,4-diamine |
| SMILES | [C-]#[N+]c1ccc2c(c1)c(CCC)nn2-c1nc(Nc2cc([N+](=O)[O-])c(N(C)CCN(C)C)cc2OC)ncc1Cl |
| InChI | InChI=1S/C27H30ClN9O3/c1-7-8-20-18-13-17(29-2)9-10-22(18)36(33-20)26-19(28)16-30-27(32-26)31-21-14-24(37(38)39)23(15-25(21)40-6)35(5)12-11-34(3)4/h9-10,13-16H,7-8,11-12H2,1,3-6H3,(H,30,31,32) |
| InChIKey | JVEVIOJORNZWAP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 118.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.05 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|