C26H22ClFN2O — CID 157323924
2-(4-chlorophenyl)-1-[6-(6-fluoro-7-isocyanoquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone (PubChem CID 157323924) has the molecular formula C26H22ClFN2O and a molecular weight of 432.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[6-(6-fluoro-7-isocyanoquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[6-(6-fluoro-7-isocyanoquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
|---|---|
| PubChem CID | 157323924 |
| Molecular Formula | C26H22ClFN2O |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[6-(6-fluoro-7-isocyanoquinolin-4-yl)spiro[2.5]octan-2-yl]ethanone |
| SMILES | [C-]#[N+]c1cc2nccc(C3CCC4(CC3)CC4C(=O)Cc3ccc(Cl)cc3)c2cc1F |
| InChI | InChI=1S/C26H22ClFN2O/c1-29-24-14-23-20(13-22(24)28)19(8-11-30-23)17-6-9-26(10-7-17)15-21(26)25(31)12-16-2-4-18(27)5-3-16/h2-5,8,11,13-14,17,21H,6-7,9-10,12,15H2 |
| InChIKey | BEMISQGKWGNLIY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 34.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|