C10H15F9O2S — CID 157327356
ethanol;2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)ethanol (PubChem CID 157327356) has the molecular formula C10H15F9O2S and a molecular weight of 370.28 g/mol. Its IUPAC name is ethanol;2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)ethanol.
| Compound Name | ethanol;2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)ethanol |
|---|---|
| PubChem CID | 157327356 |
| Molecular Formula | C10H15F9O2S |
| Molecular Weight | 370.28 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | ethanol;2-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfanyl)ethanol |
| SMILES | CCO.OCCSCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9OS.C2H6O/c9-5(10,1-3-19-4-2-18)6(11,12)7(13,14)8(15,16)17;1-2-3/h18H,1-4H2;3H,2H2,1H3 |
| InChIKey | BEWSNSBBRUMEII-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.28 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|