C18H15Cl2N3O — CID 15733135
N-[2-benzyl-4-(2,4-dichlorophenyl)imidazol-1-yl]acetamide (PubChem CID 15733135) has the molecular formula C18H15Cl2N3O and a molecular weight of 360.24 g/mol. Its IUPAC name is N-[2-benzyl-4-(2,4-dichlorophenyl)imidazol-1-yl]acetamide.
| Compound Name | N-[2-benzyl-4-(2,4-dichlorophenyl)imidazol-1-yl]acetamide |
|---|---|
| PubChem CID | 15733135 |
| Molecular Formula | C18H15Cl2N3O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-[2-benzyl-4-(2,4-dichlorophenyl)imidazol-1-yl]acetamide |
| SMILES | CC(=O)Nn1cc(-c2ccc(Cl)cc2Cl)nc1Cc1ccccc1 |
| InChI | InChI=1S/C18H15Cl2N3O/c1-12(24)22-23-11-17(15-8-7-14(19)10-16(15)20)21-18(23)9-13-5-3-2-4-6-13/h2-8,10-11H,9H2,1H3,(H,22,24) |
| InChIKey | PPUJGBMDOVPXCH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |