C16H22O3S — CID 157332433
tert-butyl (3S)-5-oxo-3-(phenylsulfanylmethyl)pentanoate (PubChem CID 157332433) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is tert-butyl (3S)-5-oxo-3-(phenylsulfanylmethyl)pentanoate.
| Compound Name | tert-butyl (3S)-5-oxo-3-(phenylsulfanylmethyl)pentanoate |
|---|---|
| PubChem CID | 157332433 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | tert-butyl (3S)-5-oxo-3-(phenylsulfanylmethyl)pentanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](CC=O)CSc1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-16(2,3)19-15(18)11-13(9-10-17)12-20-14-7-5-4-6-8-14/h4-8,10,13H,9,11-12H2,1-3H3/t13-/m0/s1 |
| InChIKey | PPOQMUFJUMAERM-ZDUSSCGKSA-N |
| XLogP | 3.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|