C30H32B2N5+ — CID 157354574
19,21-dimethyl-18-(1,2,4,6,7-pentamethyl-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium-3-yl)-14,21-diaza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8,10,12,15(20),16,18-nonaene (PubChem CID 157354574) has the molecular formula C30H32B2N5+ and a molecular weight of 484.25 g/mol. Its IUPAC name is 19,21-dimethyl-18-(1,2,4,6,7-pentamethyl-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium-3-yl)-14,21-diaza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8,10,12,15(20),16,18-nonaene.
| Compound Name | 19,21-dimethyl-18-(1,2,4,6,7-pentamethyl-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium-3-yl)-14,21-diaza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8,10,12,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 157354574 |
| Molecular Formula | C30H32B2N5+ |
| Molecular Weight | 484.25 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 19,21-dimethyl-18-(1,2,4,6,7-pentamethyl-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium-3-yl)-14,21-diaza-1-borapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-2,4,6,8,10,12,15(20),16,18-nonaene |
| SMILES | CB1N(C)c2c(C)c(C)c[n+](C)c2N1c1ccc2c(c1C)N(C)B1c3ccccc3-c3ccccc3N12 |
| InChI | InChI=1S/C30H32B2N5/c1-19-18-33(5)30-29(20(19)2)34(6)31(4)37(30)25-16-17-27-28(21(25)3)35(7)32-24-14-10-8-12-22(24)23-13-9-11-15-26(23)36(27)32/h8-18H,1-7H3/q+1 |
| InChIKey | GBKIVRVTIBMIBT-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 16.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.25 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|