C24H29BN3+ — CID 171747212
5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6,7-dimethylbenzo[d][1,3,2]benzodiazaborepine (PubChem CID 171747212) has the molecular formula C24H29BN3+ and a molecular weight of 370.33 g/mol. Its IUPAC name is 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6,7-dimethylbenzo[d][1,3,2]benzodiazaborepine.
| Compound Name | 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6,7-dimethylbenzo[d][1,3,2]benzodiazaborepine |
|---|---|
| PubChem CID | 171747212 |
| Molecular Formula | C24H29BN3+ |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 5-(4-tert-butyl-1-methylpyridin-1-ium-2-yl)-6,7-dimethylbenzo[d][1,3,2]benzodiazaborepine |
| SMILES | CB1N(C)c2ccccc2-c2ccccc2N1c1cc(C(C)(C)C)cc[n+]1C |
| InChI | InChI=1S/C24H29BN3/c1-24(2,3)18-15-16-26(5)23(17-18)28-22-14-10-8-12-20(22)19-11-7-9-13-21(19)27(6)25(28)4/h7-17H,1-6H3/q+1 |
| InChIKey | IQUANPQBVFVUEW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|