C21H39NO3 — CID 157357622
(E)-5-(dimethylamino)pent-3-en-2-one;2,2-dimethylpentan-3-one;4,4-dimethylpent-1-en-3-one (PubChem CID 157357622) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is (E)-5-(dimethylamino)pent-3-en-2-one;2,2-dimethylpentan-3-one;4,4-dimethylpent-1-en-3-one.
| Compound Name | (E)-5-(dimethylamino)pent-3-en-2-one;2,2-dimethylpentan-3-one;4,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 157357622 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | (E)-5-(dimethylamino)pent-3-en-2-one;2,2-dimethylpentan-3-one;4,4-dimethylpent-1-en-3-one |
| SMILES | C=CC(=O)C(C)(C)C.CC(=O)/C=C/CN(C)C.CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C7H13NO.C7H14O.C7H12O/c1-7(9)5-4-6-8(2)3;2*1-5-6(8)7(2,3)4/h4-5H,6H2,1-3H3;5H2,1-4H3;5H,1H2,2-4H3/b5-4+;; |
| InChIKey | BIGUNMGDHVSPFZ-SFKRKKMESA-N |
| XLogP | 4.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|