C12H21O2S+ — CID 23535039
(3,3-dimethyl-2-oxobutyl)-methyl-[(E)-4-oxopent-2-enyl]sulfanium (PubChem CID 23535039) has the molecular formula C12H21O2S+ and a molecular weight of 229.36 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl)-methyl-[(E)-4-oxopent-2-enyl]sulfanium.
| Compound Name | (3,3-dimethyl-2-oxobutyl)-methyl-[(E)-4-oxopent-2-enyl]sulfanium |
|---|---|
| PubChem CID | 23535039 |
| Molecular Formula | C12H21O2S+ |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl)-methyl-[(E)-4-oxopent-2-enyl]sulfanium |
| SMILES | CC(=O)/C=C/C[S+](C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H21O2S/c1-10(13)7-6-8-15(5)9-11(14)12(2,3)4/h6-7H,8-9H2,1-5H3/q+1/b7-6+ |
| InChIKey | LRVIBLDUUOSKSR-VOTSOKGWSA-N |
| XLogP | 1.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|