About [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+))
[(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) (PubChem CID 156642113) has the molecular formula C5H8NORb2+
and a molecular weight of 269.06 g/mol. Its IUPAC name is [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)).
Molecular Properties
| Compound Name | [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) |
| PubChem CID | 156642113 |
| Molecular Formula | C5H8NORb2+ |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.88 |
| IUPAC Name | [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) |
| SMILES | CC(=O)/C=C/C[NH-].[Rb+].[Rb+] |
| InChI | InChI=1S/C5H8NO.2Rb/c1-5(7)3-2-4-6;;/h2-3,6H,4H2,1H3;;/q-1;2*+1/b3-2+;; |
| InChIKey | XUIRQNYDZWZYCQ-WTVBWJGASA-N |
| XLogP | -4.81 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | -4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+))?
The IUPAC name of [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) (CID 156642113) is [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)).
What is the SMILES notation for [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+))?
The canonical SMILES for [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) is CC(=O)/C=C/C[NH-].[Rb+].[Rb+].
What is the InChIKey of [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+))?
The InChIKey is XUIRQNYDZWZYCQ-WTVBWJGASA-N. The full InChI is InChI=1S/C5H8NO.2Rb/c1-5(7)3-2-4-6;;/h2-3,6H,4H2,1H3;;/q-1;2*+1/b3-2+;;.
What are the key properties of [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+))?
[(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) has a molecular weight of 269.06 g/mol, XLogP of -4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4-oxopent-2-enyl]azanide;bis(rubidium(1+)) is sourced from PubChem (CID 156642113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).